C13H14F3N5O6 — CID 166759467
6-[5-(2-aminoethyl)-2-oxo-1,3-oxazolidin-3-yl]-4H-pyrazino[2,3-b][1,4]oxazin-3-one;2,2,2-trifluoroacetic acid (PubChem CID 166759467) has the molecular formula C13H14F3N5O6 and a molecular weight of 393.28 g/mol. Its IUPAC name is 6-[5-(2-aminoethyl)-2-oxo-1,3-oxazolidin-3-yl]-4H-pyrazino[2,3-b][1,4]oxazin-3-one;2,2,2-trifluoroacetic acid.
| Compound Name | 6-[5-(2-aminoethyl)-2-oxo-1,3-oxazolidin-3-yl]-4H-pyrazino[2,3-b][1,4]oxazin-3-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 166759467 |
| Molecular Formula | C13H14F3N5O6 |
| Molecular Weight | 393.28 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | 6-[5-(2-aminoethyl)-2-oxo-1,3-oxazolidin-3-yl]-4H-pyrazino[2,3-b][1,4]oxazin-3-one;2,2,2-trifluoroacetic acid |
| SMILES | NCCC1CN(c2cnc3c(n2)NC(=O)CO3)C(=O)O1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C11H13N5O4.C2HF3O2/c12-2-1-6-4-16(11(18)20-6)7-3-13-10-9(14-7)15-8(17)5-19-10;3-2(4,5)1(6)7/h3,6H,1-2,4-5,12H2,(H,14,15,17);(H,6,7) |
| InChIKey | CJSGILWXCLSIKB-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 156.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.28 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |