C24H23FN7O3+ — CID 166760071
5-amino-2-[(2,5-dimethyl-1,3-oxazol-4-yl)methyl]-7-(4-fluorophenyl)-8-(1-hydroxy-2,6-dimethylpyridin-1-ium-4-yl)-[1,2,4]triazolo[4,3-c]pyrimidin-3-one (PubChem CID 166760071) has the molecular formula C24H23FN7O3+ and a molecular weight of 476.49 g/mol. Its IUPAC name is 5-amino-2-[(2,5-dimethyl-1,3-oxazol-4-yl)methyl]-7-(4-fluorophenyl)-8-(1-hydroxy-2,6-dimethylpyridin-1-ium-4-yl)-[1,2,4]triazolo[4,3-c]pyrimidin-3-one.
| Compound Name | 5-amino-2-[(2,5-dimethyl-1,3-oxazol-4-yl)methyl]-7-(4-fluorophenyl)-8-(1-hydroxy-2,6-dimethylpyridin-1-ium-4-yl)-[1,2,4]triazolo[4,3-c]pyrimidin-3-one |
|---|---|
| PubChem CID | 166760071 |
| Molecular Formula | C24H23FN7O3+ |
| Molecular Weight | 476.49 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | 5-amino-2-[(2,5-dimethyl-1,3-oxazol-4-yl)methyl]-7-(4-fluorophenyl)-8-(1-hydroxy-2,6-dimethylpyridin-1-ium-4-yl)-[1,2,4]triazolo[4,3-c]pyrimidin-3-one |
| SMILES | Cc1nc(Cn2nc3c(-c4cc(C)[n+](O)c(C)c4)c(-c4ccc(F)cc4)nc(N)n3c2=O)c(C)o1 |
| InChI | InChI=1S/C24H22FN7O3/c1-12-9-17(10-13(2)32(12)34)20-21(16-5-7-18(25)8-6-16)28-23(26)31-22(20)29-30(24(31)33)11-19-14(3)35-15(4)27-19/h5-10,26,34H,11H2,1-4H3/p+1 |
| InChIKey | LBPIQMZMDYEYOB-UHFFFAOYSA-O |
| XLogP | 2.74 |
| TPSA | 128.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.49 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|