C8H10F7O3P — CID 166760656
4-diethoxyphosphoryl-1,1,2,3,3,4,4-heptafluorobut-1-ene (PubChem CID 166760656) has the molecular formula C8H10F7O3P and a molecular weight of 318.13 g/mol. Its IUPAC name is 4-diethoxyphosphoryl-1,1,2,3,3,4,4-heptafluorobut-1-ene.
| Compound Name | 4-diethoxyphosphoryl-1,1,2,3,3,4,4-heptafluorobut-1-ene |
|---|---|
| PubChem CID | 166760656 |
| Molecular Formula | C8H10F7O3P |
| Molecular Weight | 318.13 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | 4-diethoxyphosphoryl-1,1,2,3,3,4,4-heptafluorobut-1-ene |
| SMILES | CCOP(=O)(OCC)C(F)(F)C(F)(F)C(F)=C(F)F |
| InChI | InChI=1S/C8H10F7O3P/c1-3-17-19(16,18-4-2)8(14,15)7(12,13)5(9)6(10)11/h3-4H2,1-2H3 |
| InChIKey | ZNQIALAICIJJJN-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.13 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|