C26H15F6N3O6S2 — CID 166760719
[2-[1-naphthalen-2-yl-5-[2-(trifluoromethylsulfonyloxy)phenyl]-1,2,4-triazol-3-yl]phenyl] trifluoromethanesulfonate (PubChem CID 166760719) has the molecular formula C26H15F6N3O6S2 and a molecular weight of 643.54 g/mol. Its IUPAC name is [2-[1-naphthalen-2-yl-5-[2-(trifluoromethylsulfonyloxy)phenyl]-1,2,4-triazol-3-yl]phenyl] trifluoromethanesulfonate.
| Compound Name | [2-[1-naphthalen-2-yl-5-[2-(trifluoromethylsulfonyloxy)phenyl]-1,2,4-triazol-3-yl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 166760719 |
| Molecular Formula | C26H15F6N3O6S2 |
| Molecular Weight | 643.54 g/mol |
| Exact Mass | 643.03 |
| IUPAC Name | [2-[1-naphthalen-2-yl-5-[2-(trifluoromethylsulfonyloxy)phenyl]-1,2,4-triazol-3-yl]phenyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccccc1-c1nc(-c2ccccc2OS(=O)(=O)C(F)(F)F)n(-c2ccc3ccccc3c2)n1)C(F)(F)F |
| InChI | InChI=1S/C26H15F6N3O6S2/c27-25(28,29)42(36,37)40-21-11-5-3-9-19(21)23-33-24(20-10-4-6-12-22(20)41-43(38,39)26(30,31)32)35(34-23)18-14-13-16-7-1-2-8-17(16)15-18/h1-15H |
| InChIKey | JGISMPLPRRLHST-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 117.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.54 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|