About (1S)-1-[3-(2-cyclopropyl-4-pyridinyl)-1,2-oxazol-5-yl]ethanamine
(1S)-1-[3-(2-cyclopropyl-4-pyridinyl)-1,2-oxazol-5-yl]ethanamine (PubChem CID 166761000) has the molecular formula C13H15N3O
and a molecular weight of 229.28 g/mol. Its IUPAC name is (1S)-1-[3-(2-cyclopropyl-4-pyridinyl)-1,2-oxazol-5-yl]ethanamine.
Molecular Properties
| Compound Name | (1S)-1-[3-(2-cyclopropyl-4-pyridinyl)-1,2-oxazol-5-yl]ethanamine |
| PubChem CID | 166761000 |
| Molecular Formula | C13H15N3O |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | (1S)-1-[3-(2-cyclopropyl-4-pyridinyl)-1,2-oxazol-5-yl]ethanamine |
| SMILES | C[C@H](N)c1cc(-c2ccnc(C3CC3)c2)no1 |
| InChI | InChI=1S/C13H15N3O/c1-8(14)13-7-12(16-17-13)10-4-5-15-11(6-10)9-2-3-9/h4-9H,2-3,14H2,1H3/t8-/m0/s1 |
| InChIKey | DJCJSELIDSUNMU-QMMMGPOBSA-N |
| XLogP | 2.63 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1S)-1-[3-(2-cyclopropyl-4-pyridinyl)-1,2-oxazol-5-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-[3-(2-cyclopropyl-4-pyridinyl)-1,2-oxazol-5-yl]ethanamine?
The IUPAC name of (1S)-1-[3-(2-cyclopropyl-4-pyridinyl)-1,2-oxazol-5-yl]ethanamine (CID 166761000) is (1S)-1-[3-(2-cyclopropyl-4-pyridinyl)-1,2-oxazol-5-yl]ethanamine.
What is the SMILES notation for (1S)-1-[3-(2-cyclopropyl-4-pyridinyl)-1,2-oxazol-5-yl]ethanamine?
The canonical SMILES for (1S)-1-[3-(2-cyclopropyl-4-pyridinyl)-1,2-oxazol-5-yl]ethanamine is C[C@H](N)c1cc(-c2ccnc(C3CC3)c2)no1.
What is the InChIKey of (1S)-1-[3-(2-cyclopropyl-4-pyridinyl)-1,2-oxazol-5-yl]ethanamine?
The InChIKey is DJCJSELIDSUNMU-QMMMGPOBSA-N. The full InChI is InChI=1S/C13H15N3O/c1-8(14)13-7-12(16-17-13)10-4-5-15-11(6-10)9-2-3-9/h4-9H,2-3,14H2,1H3/t8-/m0/s1.
What are the key properties of (1S)-1-[3-(2-cyclopropyl-4-pyridinyl)-1,2-oxazol-5-yl]ethanamine?
(1S)-1-[3-(2-cyclopropyl-4-pyridinyl)-1,2-oxazol-5-yl]ethanamine has a molecular weight of 229.28 g/mol, XLogP of 2.63, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-[3-(2-cyclopropyl-4-pyridinyl)-1,2-oxazol-5-yl]ethanamine is sourced from PubChem (CID 166761000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).