C16H19N3 — CID 166761284
2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4-[(2E,4Z)-hexa-2,4-dien-3-yl]-1,3,5-triazine (PubChem CID 166761284) has the molecular formula C16H19N3 and a molecular weight of 253.35 g/mol. Its IUPAC name is 2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4-[(2E,4Z)-hexa-2,4-dien-3-yl]-1,3,5-triazine.
| Compound Name | 2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4-[(2E,4Z)-hexa-2,4-dien-3-yl]-1,3,5-triazine |
|---|---|
| PubChem CID | 166761284 |
| Molecular Formula | C16H19N3 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | 2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4-[(2E,4Z)-hexa-2,4-dien-3-yl]-1,3,5-triazine |
| SMILES | C=C/C=C(\C=C/C)c1ncnc(C(/C=C\C)=C/C)n1 |
| InChI | InChI=1S/C16H19N3/c1-5-9-13(8-4)15-17-12-18-16(19-15)14(10-6-2)11-7-3/h5-12H,2H2,1,3-4H3/b9-5-,11-7-,13-8+,14-10+ |
| InChIKey | YFDCDNXZDMYEEZ-QCVGIFRYSA-N |
| XLogP | 4.00 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|