C17H19N3 — CID 166761286
2,4-bis[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1,3,5-triazine (PubChem CID 166761286) has the molecular formula C17H19N3 and a molecular weight of 265.36 g/mol. Its IUPAC name is 2,4-bis[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1,3,5-triazine.
| Compound Name | 2,4-bis[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1,3,5-triazine |
|---|---|
| PubChem CID | 166761286 |
| Molecular Formula | C17H19N3 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | 2,4-bis[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1,3,5-triazine |
| SMILES | C=C/C=C\C(=C/C)c1ncnc(C(/C=C\C=C)=C/C)n1 |
| InChI | InChI=1S/C17H19N3/c1-5-9-11-14(7-3)16-18-13-19-17(20-16)15(8-4)12-10-6-2/h5-13H,1-2H2,3-4H3/b11-9-,12-10-,14-7+,15-8+ |
| InChIKey | ZYGKFBKSRIALDR-QKNWSJPTSA-N |
| XLogP | 4.16 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|