C27H31N5O3S — CID 166762375
tert-butyl N-[[6-[2-[4-[3-[(2-ethylimidazol-1-yl)methyl]-1,2-oxazol-5-yl]phenyl]ethynyl]-3-azabicyclo[3.1.0]hexan-3-yl]sulfanyl]carbamate (PubChem CID 166762375) has the molecular formula C27H31N5O3S and a molecular weight of 505.64 g/mol. Its IUPAC name is tert-butyl N-[[6-[2-[4-[3-[(2-ethylimidazol-1-yl)methyl]-1,2-oxazol-5-yl]phenyl]ethynyl]-3-azabicyclo[3.1.0]hexan-3-yl]sulfanyl]carbamate.
| Compound Name | tert-butyl N-[[6-[2-[4-[3-[(2-ethylimidazol-1-yl)methyl]-1,2-oxazol-5-yl]phenyl]ethynyl]-3-azabicyclo[3.1.0]hexan-3-yl]sulfanyl]carbamate |
|---|---|
| PubChem CID | 166762375 |
| Molecular Formula | C27H31N5O3S |
| Molecular Weight | 505.64 g/mol |
| Exact Mass | 505.21 |
| IUPAC Name | tert-butyl N-[[6-[2-[4-[3-[(2-ethylimidazol-1-yl)methyl]-1,2-oxazol-5-yl]phenyl]ethynyl]-3-azabicyclo[3.1.0]hexan-3-yl]sulfanyl]carbamate |
| SMILES | CCc1nccn1Cc1cc(-c2ccc(C#CC3C4CN(SNC(=O)OC(C)(C)C)CC34)cc2)on1 |
| InChI | InChI=1S/C27H31N5O3S/c1-5-25-28-12-13-31(25)15-20-14-24(35-29-20)19-9-6-18(7-10-19)8-11-21-22-16-32(17-23(21)22)36-30-26(33)34-27(2,3)4/h6-7,9-10,12-14,21-23H,5,15-17H2,1-4H3,(H,30,33) |
| InChIKey | TYTZPLDUFNLISF-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 85.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.64 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|