C9H14FN3 — CID 166762632
N-[(Z)-2-fluoroethenyl]-N'-methyl-1,2,3,6-tetrahydropyridine-4-carboximidamide (PubChem CID 166762632) has the molecular formula C9H14FN3 and a molecular weight of 183.23 g/mol. Its IUPAC name is N-[(Z)-2-fluoroethenyl]-N'-methyl-1,2,3,6-tetrahydropyridine-4-carboximidamide.
| Compound Name | N-[(Z)-2-fluoroethenyl]-N'-methyl-1,2,3,6-tetrahydropyridine-4-carboximidamide |
|---|---|
| PubChem CID | 166762632 |
| Molecular Formula | C9H14FN3 |
| Molecular Weight | 183.23 g/mol |
| Exact Mass | 183.12 |
| IUPAC Name | N-[(Z)-2-fluoroethenyl]-N'-methyl-1,2,3,6-tetrahydropyridine-4-carboximidamide |
| SMILES | C/N=C(\N/C=C\F)C1=CCNCC1 |
| InChI | InChI=1S/C9H14FN3/c1-11-9(13-7-4-10)8-2-5-12-6-3-8/h2,4,7,12H,3,5-6H2,1H3,(H,11,13)/b7-4- |
| InChIKey | NXCKVLGXWKIJSM-DAXSKMNVSA-N |
| XLogP | 0.96 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.23 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|