C27H38N4O2 — CID 166762947
1-[(3R)-3-hydroxy-3,10,13-trimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-2-pyrazolo[3,4-b]pyrazin-2-ylethanone (PubChem CID 166762947) has the molecular formula C27H38N4O2 and a molecular weight of 450.63 g/mol. Its IUPAC name is 1-[(3R)-3-hydroxy-3,10,13-trimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-2-pyrazolo[3,4-b]pyrazin-2-ylethanone.
| Compound Name | 1-[(3R)-3-hydroxy-3,10,13-trimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-2-pyrazolo[3,4-b]pyrazin-2-ylethanone |
|---|---|
| PubChem CID | 166762947 |
| Molecular Formula | C27H38N4O2 |
| Molecular Weight | 450.63 g/mol |
| Exact Mass | 450.30 |
| IUPAC Name | 1-[(3R)-3-hydroxy-3,10,13-trimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-2-pyrazolo[3,4-b]pyrazin-2-ylethanone |
| SMILES | CC12CC[C@@](C)(O)CC1CCC1C2CCC2(C)C(C(=O)Cn3cc4nccnc4n3)CCC12 |
| InChI | InChI=1S/C27H38N4O2/c1-25(33)10-11-26(2)17(14-25)4-5-18-19-6-7-21(27(19,3)9-8-20(18)26)23(32)16-31-15-22-24(30-31)29-13-12-28-22/h12-13,15,17-21,33H,4-11,14,16H2,1-3H3/t17?,18?,19?,20?,21?,25-,26?,27?/m1/s1 |
| InChIKey | BCFKGRKUOGJYQM-QSRYJWATSA-N |
| XLogP | 4.81 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.63 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |