About 6-N-ethyl-4-methyl-1,4-dihydropyrimidine-5,6-diamine
6-N-ethyl-4-methyl-1,4-dihydropyrimidine-5,6-diamine (PubChem CID 166763489) has the molecular formula C7H14N4
and a molecular weight of 154.22 g/mol. Its IUPAC name is 6-N-ethyl-4-methyl-1,4-dihydropyrimidine-5,6-diamine.
Molecular Properties
| Compound Name | 6-N-ethyl-4-methyl-1,4-dihydropyrimidine-5,6-diamine |
| PubChem CID | 166763489 |
| Molecular Formula | C7H14N4 |
| Molecular Weight | 154.22 g/mol |
| Exact Mass | 154.12 |
| IUPAC Name | 6-N-ethyl-4-methyl-1,4-dihydropyrimidine-5,6-diamine |
| SMILES | CCNC1=C(N)C(C)N=CN1 |
| InChI | InChI=1S/C7H14N4/c1-3-9-7-6(8)5(2)10-4-11-7/h4-5,9H,3,8H2,1-2H3,(H,10,11) |
| InChIKey | PPRJQERIXZNCFS-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.22 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-N-ethyl-4-methyl-1,4-dihydropyrimidine-5,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-N-ethyl-4-methyl-1,4-dihydropyrimidine-5,6-diamine?
The IUPAC name of 6-N-ethyl-4-methyl-1,4-dihydropyrimidine-5,6-diamine (CID 166763489) is 6-N-ethyl-4-methyl-1,4-dihydropyrimidine-5,6-diamine.
What is the SMILES notation for 6-N-ethyl-4-methyl-1,4-dihydropyrimidine-5,6-diamine?
The canonical SMILES for 6-N-ethyl-4-methyl-1,4-dihydropyrimidine-5,6-diamine is CCNC1=C(N)C(C)N=CN1.
What is the InChIKey of 6-N-ethyl-4-methyl-1,4-dihydropyrimidine-5,6-diamine?
The InChIKey is PPRJQERIXZNCFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N4/c1-3-9-7-6(8)5(2)10-4-11-7/h4-5,9H,3,8H2,1-2H3,(H,10,11).
What are the key properties of 6-N-ethyl-4-methyl-1,4-dihydropyrimidine-5,6-diamine?
6-N-ethyl-4-methyl-1,4-dihydropyrimidine-5,6-diamine has a molecular weight of 154.22 g/mol, XLogP of -0.26, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-N-ethyl-4-methyl-1,4-dihydropyrimidine-5,6-diamine is sourced from PubChem (CID 166763489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).