C21H28ClNO — CID 166763754
4-chloro-N-[1-(cyclohexylmethoxy)ethenyl]-N-[(2E,4Z)-hexa-2,4-dien-2-yl]aniline (PubChem CID 166763754) has the molecular formula C21H28ClNO and a molecular weight of 345.91 g/mol. Its IUPAC name is 4-chloro-N-[1-(cyclohexylmethoxy)ethenyl]-N-[(2E,4Z)-hexa-2,4-dien-2-yl]aniline.
| Compound Name | 4-chloro-N-[1-(cyclohexylmethoxy)ethenyl]-N-[(2E,4Z)-hexa-2,4-dien-2-yl]aniline |
|---|---|
| PubChem CID | 166763754 |
| Molecular Formula | C21H28ClNO |
| Molecular Weight | 345.91 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | 4-chloro-N-[1-(cyclohexylmethoxy)ethenyl]-N-[(2E,4Z)-hexa-2,4-dien-2-yl]aniline |
| SMILES | C=C(OCC1CCCCC1)N(/C(C)=C/C=C\C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H28ClNO/c1-4-5-9-17(2)23(21-14-12-20(22)13-15-21)18(3)24-16-19-10-7-6-8-11-19/h4-5,9,12-15,19H,3,6-8,10-11,16H2,1-2H3/b5-4-,17-9+ |
| InChIKey | ODPBABOJDXQIHP-JHDPWQDNSA-N |
| XLogP | 6.69 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.91 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|