About N-[(1Z,3Z)-3-chlorohepta-1,3-dienyl]ethanimidoyl chloride
N-[(1Z,3Z)-3-chlorohepta-1,3-dienyl]ethanimidoyl chloride (PubChem CID 166763901) has the molecular formula C9H13Cl2N
and a molecular weight of 206.12 g/mol. Its IUPAC name is N-[(1Z,3Z)-3-chlorohepta-1,3-dienyl]ethanimidoyl chloride.
Molecular Properties
| Compound Name | N-[(1Z,3Z)-3-chlorohepta-1,3-dienyl]ethanimidoyl chloride |
| PubChem CID | 166763901 |
| Molecular Formula | C9H13Cl2N |
| Molecular Weight | 206.12 g/mol |
| Exact Mass | 205.04 |
| IUPAC Name | N-[(1Z,3Z)-3-chlorohepta-1,3-dienyl]ethanimidoyl chloride |
| SMILES | CCC/C=C(Cl)/C=C\N=C(/C)Cl |
| InChI | InChI=1S/C9H13Cl2N/c1-3-4-5-9(11)6-7-12-8(2)10/h5-7H,3-4H2,1-2H3/b7-6-,9-5-,12-8+ |
| InChIKey | XTJZTOUUEIQDDX-YNYPWNHBSA-N |
| XLogP | 4.08 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.12 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(1Z,3Z)-3-chlorohepta-1,3-dienyl]ethanimidoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1Z,3Z)-3-chlorohepta-1,3-dienyl]ethanimidoyl chloride?
The IUPAC name of N-[(1Z,3Z)-3-chlorohepta-1,3-dienyl]ethanimidoyl chloride (CID 166763901) is N-[(1Z,3Z)-3-chlorohepta-1,3-dienyl]ethanimidoyl chloride.
What is the SMILES notation for N-[(1Z,3Z)-3-chlorohepta-1,3-dienyl]ethanimidoyl chloride?
The canonical SMILES for N-[(1Z,3Z)-3-chlorohepta-1,3-dienyl]ethanimidoyl chloride is CCC/C=C(Cl)/C=C\N=C(/C)Cl.
What is the InChIKey of N-[(1Z,3Z)-3-chlorohepta-1,3-dienyl]ethanimidoyl chloride?
The InChIKey is XTJZTOUUEIQDDX-YNYPWNHBSA-N. The full InChI is InChI=1S/C9H13Cl2N/c1-3-4-5-9(11)6-7-12-8(2)10/h5-7H,3-4H2,1-2H3/b7-6-,9-5-,12-8+.
What are the key properties of N-[(1Z,3Z)-3-chlorohepta-1,3-dienyl]ethanimidoyl chloride?
N-[(1Z,3Z)-3-chlorohepta-1,3-dienyl]ethanimidoyl chloride has a molecular weight of 206.12 g/mol, XLogP of 4.08, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1Z,3Z)-3-chlorohepta-1,3-dienyl]ethanimidoyl chloride is sourced from PubChem (CID 166763901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).