About 2,9-bis(ethenyl)-6-phenyl-5,6-dihydrophenanthridine
2,9-bis(ethenyl)-6-phenyl-5,6-dihydrophenanthridine (PubChem CID 166764266) has the molecular formula C23H19N
and a molecular weight of 309.41 g/mol. Its IUPAC name is 2,9-bis(ethenyl)-6-phenyl-5,6-dihydrophenanthridine.
Molecular Properties
| Compound Name | 2,9-bis(ethenyl)-6-phenyl-5,6-dihydrophenanthridine |
| PubChem CID | 166764266 |
| Molecular Formula | C23H19N |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 2,9-bis(ethenyl)-6-phenyl-5,6-dihydrophenanthridine |
| SMILES | C=Cc1ccc2c(c1)-c1cc(C=C)ccc1C(c1ccccc1)N2 |
| InChI | InChI=1S/C23H19N/c1-3-16-10-12-19-20(14-16)21-15-17(4-2)11-13-22(21)24-23(19)18-8-6-5-7-9-18/h3-15,23-24H,1-2H2 |
| InChIKey | YYPKGNTUQDOOSP-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,9-bis(ethenyl)-6-phenyl-5,6-dihydrophenanthridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,9-bis(ethenyl)-6-phenyl-5,6-dihydrophenanthridine?
The IUPAC name of 2,9-bis(ethenyl)-6-phenyl-5,6-dihydrophenanthridine (CID 166764266) is 2,9-bis(ethenyl)-6-phenyl-5,6-dihydrophenanthridine.
What is the SMILES notation for 2,9-bis(ethenyl)-6-phenyl-5,6-dihydrophenanthridine?
The canonical SMILES for 2,9-bis(ethenyl)-6-phenyl-5,6-dihydrophenanthridine is C=Cc1ccc2c(c1)-c1cc(C=C)ccc1C(c1ccccc1)N2.
What is the InChIKey of 2,9-bis(ethenyl)-6-phenyl-5,6-dihydrophenanthridine?
The InChIKey is YYPKGNTUQDOOSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19N/c1-3-16-10-12-19-20(14-16)21-15-17(4-2)11-13-22(21)24-23(19)18-8-6-5-7-9-18/h3-15,23-24H,1-2H2.
What are the key properties of 2,9-bis(ethenyl)-6-phenyl-5,6-dihydrophenanthridine?
2,9-bis(ethenyl)-6-phenyl-5,6-dihydrophenanthridine has a molecular weight of 309.41 g/mol, XLogP of 6.15, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,9-bis(ethenyl)-6-phenyl-5,6-dihydrophenanthridine is sourced from PubChem (CID 166764266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).