C12H20N2 — CID 166764270
2-methyl-2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azonine (PubChem CID 166764270) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is 2-methyl-2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azonine.
| Compound Name | 2-methyl-2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azonine |
|---|---|
| PubChem CID | 166764270 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 2-methyl-2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azonine |
| SMILES | CC1CCN2CCCCCC=CC2=N1 |
| InChI | InChI=1S/C12H20N2/c1-11-8-10-14-9-6-4-2-3-5-7-12(14)13-11/h5,7,11H,2-4,6,8-10H2,1H3 |
| InChIKey | SOGJXPSBFMBCPN-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |