About (Z)-4-amino-N',2-dimethyl-N-[2-[methyl(propyl)amino]ethyl]but-2-enimidamide
(Z)-4-amino-N',2-dimethyl-N-[2-[methyl(propyl)amino]ethyl]but-2-enimidamide (PubChem CID 166764347) has the molecular formula C12H26N4
and a molecular weight of 226.37 g/mol. Its IUPAC name is (Z)-4-amino-N',2-dimethyl-N-[2-[methyl(propyl)amino]ethyl]but-2-enimidamide.
Molecular Properties
| Compound Name | (Z)-4-amino-N',2-dimethyl-N-[2-[methyl(propyl)amino]ethyl]but-2-enimidamide |
| PubChem CID | 166764347 |
| Molecular Formula | C12H26N4 |
| Molecular Weight | 226.37 g/mol |
| Exact Mass | 226.22 |
| IUPAC Name | (Z)-4-amino-N',2-dimethyl-N-[2-[methyl(propyl)amino]ethyl]but-2-enimidamide |
| SMILES | CCCN(C)CCNC(=N\C)/C(C)=C\CN |
| InChI | InChI=1S/C12H26N4/c1-5-9-16(4)10-8-15-12(14-3)11(2)6-7-13/h6H,5,7-10,13H2,1-4H3,(H,14,15)/b11-6- |
| InChIKey | AZMPKAKFXRGBGS-WDZFZDKYSA-N |
| XLogP | 0.85 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.37 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (Z)-4-amino-N',2-dimethyl-N-[2-[methyl(propyl)amino]ethyl]but-2-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4-amino-N',2-dimethyl-N-[2-[methyl(propyl)amino]ethyl]but-2-enimidamide?
The IUPAC name of (Z)-4-amino-N',2-dimethyl-N-[2-[methyl(propyl)amino]ethyl]but-2-enimidamide (CID 166764347) is (Z)-4-amino-N',2-dimethyl-N-[2-[methyl(propyl)amino]ethyl]but-2-enimidamide.
What is the SMILES notation for (Z)-4-amino-N',2-dimethyl-N-[2-[methyl(propyl)amino]ethyl]but-2-enimidamide?
The canonical SMILES for (Z)-4-amino-N',2-dimethyl-N-[2-[methyl(propyl)amino]ethyl]but-2-enimidamide is CCCN(C)CCNC(=N\C)/C(C)=C\CN.
What is the InChIKey of (Z)-4-amino-N',2-dimethyl-N-[2-[methyl(propyl)amino]ethyl]but-2-enimidamide?
The InChIKey is AZMPKAKFXRGBGS-WDZFZDKYSA-N. The full InChI is InChI=1S/C12H26N4/c1-5-9-16(4)10-8-15-12(14-3)11(2)6-7-13/h6H,5,7-10,13H2,1-4H3,(H,14,15)/b11-6-.
What are the key properties of (Z)-4-amino-N',2-dimethyl-N-[2-[methyl(propyl)amino]ethyl]but-2-enimidamide?
(Z)-4-amino-N',2-dimethyl-N-[2-[methyl(propyl)amino]ethyl]but-2-enimidamide has a molecular weight of 226.37 g/mol, XLogP of 0.85, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-amino-N',2-dimethyl-N-[2-[methyl(propyl)amino]ethyl]but-2-enimidamide is sourced from PubChem (CID 166764347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).