C41H38ClN7O4S — CID 166764522
4-[4-[[8-(4-chlorophenyl)spiro[3.5]non-7-en-7-yl]methyl]piperazin-1-yl]-N-(4-cyano-3-nitrophenyl)sulfanyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzamide (PubChem CID 166764522) has the molecular formula C41H38ClN7O4S and a molecular weight of 760.32 g/mol. Its IUPAC name is 4-[4-[[8-(4-chlorophenyl)spiro[3.5]non-7-en-7-yl]methyl]piperazin-1-yl]-N-(4-cyano-3-nitrophenyl)sulfanyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzamide.
| Compound Name | 4-[4-[[8-(4-chlorophenyl)spiro[3.5]non-7-en-7-yl]methyl]piperazin-1-yl]-N-(4-cyano-3-nitrophenyl)sulfanyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzamide |
|---|---|
| PubChem CID | 166764522 |
| Molecular Formula | C41H38ClN7O4S |
| Molecular Weight | 760.32 g/mol |
| Exact Mass | 759.24 |
| IUPAC Name | 4-[4-[[8-(4-chlorophenyl)spiro[3.5]non-7-en-7-yl]methyl]piperazin-1-yl]-N-(4-cyano-3-nitrophenyl)sulfanyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzamide |
| SMILES | N#Cc1ccc(SNC(=O)c2ccc(N3CCN(CC4=C(c5ccc(Cl)cc5)CC5(CCC5)CC4)CC3)cc2Oc2cnc3[nH]ccc3c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C41H38ClN7O4S/c42-31-5-2-27(3-6-31)36-23-41(12-1-13-41)14-10-30(36)26-47-16-18-48(19-17-47)32-7-9-35(38(21-32)53-33-20-28-11-15-44-39(28)45-25-33)40(50)46-54-34-8-4-29(24-43)37(22-34)49(51)52/h2-9,11,15,20-22,25H,1,10,12-14,16-19,23,26H2,(H,44,45)(H,46,50) |
| InChIKey | SJHGCVFTXJSPCK-UHFFFAOYSA-N |
| XLogP | 9.16 |
| TPSA | 140.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.32 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|