About 8-fluoro-9-propan-2-yl-4,5-dihydropurin-6-amine
8-fluoro-9-propan-2-yl-4,5-dihydropurin-6-amine (PubChem CID 166765040) has the molecular formula C8H12FN5
and a molecular weight of 197.22 g/mol. Its IUPAC name is 8-fluoro-9-propan-2-yl-4,5-dihydropurin-6-amine.
Molecular Properties
| Compound Name | 8-fluoro-9-propan-2-yl-4,5-dihydropurin-6-amine |
| PubChem CID | 166765040 |
| Molecular Formula | C8H12FN5 |
| Molecular Weight | 197.22 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | 8-fluoro-9-propan-2-yl-4,5-dihydropurin-6-amine |
| SMILES | CC(C)N1C(F)=NC2C(N)=NC=NC21 |
| InChI | InChI=1S/C8H12FN5/c1-4(2)14-7-5(13-8(14)9)6(10)11-3-12-7/h3-5,7H,1-2H3,(H2,10,11,12) |
| InChIKey | BIXHZWPOFVAFFP-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 66.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.22 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 8-fluoro-9-propan-2-yl-4,5-dihydropurin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-fluoro-9-propan-2-yl-4,5-dihydropurin-6-amine?
The IUPAC name of 8-fluoro-9-propan-2-yl-4,5-dihydropurin-6-amine (CID 166765040) is 8-fluoro-9-propan-2-yl-4,5-dihydropurin-6-amine.
What is the SMILES notation for 8-fluoro-9-propan-2-yl-4,5-dihydropurin-6-amine?
The canonical SMILES for 8-fluoro-9-propan-2-yl-4,5-dihydropurin-6-amine is CC(C)N1C(F)=NC2C(N)=NC=NC21.
What is the InChIKey of 8-fluoro-9-propan-2-yl-4,5-dihydropurin-6-amine?
The InChIKey is BIXHZWPOFVAFFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12FN5/c1-4(2)14-7-5(13-8(14)9)6(10)11-3-12-7/h3-5,7H,1-2H3,(H2,10,11,12).
What are the key properties of 8-fluoro-9-propan-2-yl-4,5-dihydropurin-6-amine?
8-fluoro-9-propan-2-yl-4,5-dihydropurin-6-amine has a molecular weight of 197.22 g/mol, XLogP of 0.13, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-fluoro-9-propan-2-yl-4,5-dihydropurin-6-amine is sourced from PubChem (CID 166765040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).