About 2-chloro-3-ethyl-4,5,6-trifluorophenol
2-chloro-3-ethyl-4,5,6-trifluorophenol (PubChem CID 166765191) has the molecular formula C8H6ClF3O
and a molecular weight of 210.58 g/mol. Its IUPAC name is 2-chloro-3-ethyl-4,5,6-trifluorophenol.
Molecular Properties
| Compound Name | 2-chloro-3-ethyl-4,5,6-trifluorophenol |
| PubChem CID | 166765191 |
| Molecular Formula | C8H6ClF3O |
| Molecular Weight | 210.58 g/mol |
| Exact Mass | 210.01 |
| IUPAC Name | 2-chloro-3-ethyl-4,5,6-trifluorophenol |
| SMILES | CCc1c(F)c(F)c(F)c(O)c1Cl |
| InChI | InChI=1S/C8H6ClF3O/c1-2-3-4(9)8(13)7(12)6(11)5(3)10/h13H,2H2,1H3 |
| InChIKey | GTUKDZSQVATUNU-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.58 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-3-ethyl-4,5,6-trifluorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-3-ethyl-4,5,6-trifluorophenol?
The IUPAC name of 2-chloro-3-ethyl-4,5,6-trifluorophenol (CID 166765191) is 2-chloro-3-ethyl-4,5,6-trifluorophenol.
What is the SMILES notation for 2-chloro-3-ethyl-4,5,6-trifluorophenol?
The canonical SMILES for 2-chloro-3-ethyl-4,5,6-trifluorophenol is CCc1c(F)c(F)c(F)c(O)c1Cl.
What is the InChIKey of 2-chloro-3-ethyl-4,5,6-trifluorophenol?
The InChIKey is GTUKDZSQVATUNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6ClF3O/c1-2-3-4(9)8(13)7(12)6(11)5(3)10/h13H,2H2,1H3.
What are the key properties of 2-chloro-3-ethyl-4,5,6-trifluorophenol?
2-chloro-3-ethyl-4,5,6-trifluorophenol has a molecular weight of 210.58 g/mol, XLogP of 3.03, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-3-ethyl-4,5,6-trifluorophenol is sourced from PubChem (CID 166765191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).