About 1-chloro-2-ethyl-3,5,6-trifluoro-4-methylbenzene
1-chloro-2-ethyl-3,5,6-trifluoro-4-methylbenzene (PubChem CID 166765212) has the molecular formula C9H8ClF3
and a molecular weight of 208.61 g/mol. Its IUPAC name is 1-chloro-2-ethyl-3,5,6-trifluoro-4-methylbenzene.
Molecular Properties
| Compound Name | 1-chloro-2-ethyl-3,5,6-trifluoro-4-methylbenzene |
| PubChem CID | 166765212 |
| Molecular Formula | C9H8ClF3 |
| Molecular Weight | 208.61 g/mol |
| Exact Mass | 208.03 |
| IUPAC Name | 1-chloro-2-ethyl-3,5,6-trifluoro-4-methylbenzene |
| SMILES | CCc1c(F)c(C)c(F)c(F)c1Cl |
| InChI | InChI=1S/C9H8ClF3/c1-3-5-6(10)9(13)8(12)4(2)7(5)11/h3H2,1-2H3 |
| InChIKey | PAITYBDFHWFIRI-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.61 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-2-ethyl-3,5,6-trifluoro-4-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-2-ethyl-3,5,6-trifluoro-4-methylbenzene?
The IUPAC name of 1-chloro-2-ethyl-3,5,6-trifluoro-4-methylbenzene (CID 166765212) is 1-chloro-2-ethyl-3,5,6-trifluoro-4-methylbenzene.
What is the SMILES notation for 1-chloro-2-ethyl-3,5,6-trifluoro-4-methylbenzene?
The canonical SMILES for 1-chloro-2-ethyl-3,5,6-trifluoro-4-methylbenzene is CCc1c(F)c(C)c(F)c(F)c1Cl.
What is the InChIKey of 1-chloro-2-ethyl-3,5,6-trifluoro-4-methylbenzene?
The InChIKey is PAITYBDFHWFIRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8ClF3/c1-3-5-6(10)9(13)8(12)4(2)7(5)11/h3H2,1-2H3.
What are the key properties of 1-chloro-2-ethyl-3,5,6-trifluoro-4-methylbenzene?
1-chloro-2-ethyl-3,5,6-trifluoro-4-methylbenzene has a molecular weight of 208.61 g/mol, XLogP of 3.63, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-2-ethyl-3,5,6-trifluoro-4-methylbenzene is sourced from PubChem (CID 166765212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).