C23H24O7 — CID 166765216
18-(hydroxymethyl)-6,7-dimethoxy-18-methyl-10,13,19-trioxatetracyclo[12.8.0.04,9.015,20]docosa-1(14),4,6,8,15(20),16,21-heptaen-2-one (PubChem CID 166765216) has the molecular formula C23H24O7 and a molecular weight of 412.44 g/mol. Its IUPAC name is 18-(hydroxymethyl)-6,7-dimethoxy-18-methyl-10,13,19-trioxatetracyclo[12.8.0.04,9.015,20]docosa-1(14),4,6,8,15(20),16,21-heptaen-2-one.
| Compound Name | 18-(hydroxymethyl)-6,7-dimethoxy-18-methyl-10,13,19-trioxatetracyclo[12.8.0.04,9.015,20]docosa-1(14),4,6,8,15(20),16,21-heptaen-2-one |
|---|---|
| PubChem CID | 166765216 |
| Molecular Formula | C23H24O7 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 18-(hydroxymethyl)-6,7-dimethoxy-18-methyl-10,13,19-trioxatetracyclo[12.8.0.04,9.015,20]docosa-1(14),4,6,8,15(20),16,21-heptaen-2-one |
| SMILES | COc1cc2c(cc1OC)OCCOc1c(ccc3c1C=CC(C)(CO)O3)C(=O)C2 |
| InChI | InChI=1S/C23H24O7/c1-23(13-24)7-6-16-18(30-23)5-4-15-17(25)10-14-11-20(26-2)21(27-3)12-19(14)28-8-9-29-22(15)16/h4-7,11-12,24H,8-10,13H2,1-3H3 |
| InChIKey | HGKPENIAPJOEED-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |