C25H26N2O2S — CID 166765303
(16S)-10,10,16-trimethyl-5-[(2-sulfanylphenyl)iminomethyl]-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one (PubChem CID 166765303) has the molecular formula C25H26N2O2S and a molecular weight of 418.56 g/mol. Its IUPAC name is (16S)-10,10,16-trimethyl-5-[(2-sulfanylphenyl)iminomethyl]-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one.
| Compound Name | (16S)-10,10,16-trimethyl-5-[(2-sulfanylphenyl)iminomethyl]-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one |
|---|---|
| PubChem CID | 166765303 |
| Molecular Formula | C25H26N2O2S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | (16S)-10,10,16-trimethyl-5-[(2-sulfanylphenyl)iminomethyl]-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one |
| SMILES | C[C@H]1CCN2CCC(C)(C)c3cc4cc(/C=N/c5ccccc5S)c(=O)oc4c1c32 |
| InChI | InChI=1S/C25H26N2O2S/c1-15-8-10-27-11-9-25(2,3)18-13-16-12-17(14-26-19-6-4-5-7-20(19)30)24(28)29-23(16)21(15)22(18)27/h4-7,12-15,30H,8-11H2,1-3H3/b26-14+/t15-/m0/s1 |
| InChIKey | LCCOBKQKYJULNM-IXORVSQSSA-N |
| XLogP | 5.83 |
| TPSA | 45.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|