About [(2E)-6,7-dihydroxy-2-methyl-4-(propan-2-ylcarbamoyloxy)cyclooct-2-en-1-yl] N-tert-butylcarbamate
[(2E)-6,7-dihydroxy-2-methyl-4-(propan-2-ylcarbamoyloxy)cyclooct-2-en-1-yl] N-tert-butylcarbamate (PubChem CID 166765884) has the molecular formula C18H32N2O6
and a molecular weight of 372.46 g/mol. Its IUPAC name is [(2E)-6,7-dihydroxy-2-methyl-4-(propan-2-ylcarbamoyloxy)cyclooct-2-en-1-yl] N-tert-butylcarbamate.
Molecular Properties
| Compound Name | [(2E)-6,7-dihydroxy-2-methyl-4-(propan-2-ylcarbamoyloxy)cyclooct-2-en-1-yl] N-tert-butylcarbamate |
| PubChem CID | 166765884 |
| Molecular Formula | C18H32N2O6 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | [(2E)-6,7-dihydroxy-2-methyl-4-(propan-2-ylcarbamoyloxy)cyclooct-2-en-1-yl] N-tert-butylcarbamate |
| SMILES | C/C1=C/C(OC(=O)NC(C)C)CC(O)C(O)CC1OC(=O)NC(C)(C)C |
| InChI | InChI=1S/C18H32N2O6/c1-10(2)19-16(23)25-12-7-11(3)15(9-14(22)13(21)8-12)26-17(24)20-18(4,5)6/h7,10,12-15,21-22H,8-9H2,1-6H3,(H,19,23)(H,20,24)/b11-7- |
| InChIKey | QSRQUEULJNRLMM-XFFZJAGNSA-N |
| XLogP | 1.84 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(2E)-6,7-dihydroxy-2-methyl-4-(propan-2-ylcarbamoyloxy)cyclooct-2-en-1-yl] N-tert-butylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2E)-6,7-dihydroxy-2-methyl-4-(propan-2-ylcarbamoyloxy)cyclooct-2-en-1-yl] N-tert-butylcarbamate?
The IUPAC name of [(2E)-6,7-dihydroxy-2-methyl-4-(propan-2-ylcarbamoyloxy)cyclooct-2-en-1-yl] N-tert-butylcarbamate (CID 166765884) is [(2E)-6,7-dihydroxy-2-methyl-4-(propan-2-ylcarbamoyloxy)cyclooct-2-en-1-yl] N-tert-butylcarbamate.
What is the SMILES notation for [(2E)-6,7-dihydroxy-2-methyl-4-(propan-2-ylcarbamoyloxy)cyclooct-2-en-1-yl] N-tert-butylcarbamate?
The canonical SMILES for [(2E)-6,7-dihydroxy-2-methyl-4-(propan-2-ylcarbamoyloxy)cyclooct-2-en-1-yl] N-tert-butylcarbamate is C/C1=C/C(OC(=O)NC(C)C)CC(O)C(O)CC1OC(=O)NC(C)(C)C.
What is the InChIKey of [(2E)-6,7-dihydroxy-2-methyl-4-(propan-2-ylcarbamoyloxy)cyclooct-2-en-1-yl] N-tert-butylcarbamate?
The InChIKey is QSRQUEULJNRLMM-XFFZJAGNSA-N. The full InChI is InChI=1S/C18H32N2O6/c1-10(2)19-16(23)25-12-7-11(3)15(9-14(22)13(21)8-12)26-17(24)20-18(4,5)6/h7,10,12-15,21-22H,8-9H2,1-6H3,(H,19,23)(H,20,24)/b11-7-.
What are the key properties of [(2E)-6,7-dihydroxy-2-methyl-4-(propan-2-ylcarbamoyloxy)cyclooct-2-en-1-yl] N-tert-butylcarbamate?
[(2E)-6,7-dihydroxy-2-methyl-4-(propan-2-ylcarbamoyloxy)cyclooct-2-en-1-yl] N-tert-butylcarbamate has a molecular weight of 372.46 g/mol, XLogP of 1.84, 3 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(2E)-6,7-dihydroxy-2-methyl-4-(propan-2-ylcarbamoyloxy)cyclooct-2-en-1-yl] N-tert-butylcarbamate is sourced from PubChem (CID 166765884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).