C27H23N5O2 — CID 166766008
(3R)-3-[2-[3-(4-amino-8-phenylpyrido[3,2-d]pyrimidin-6-yl)phenyl]ethynyl]-3-hydroxy-1-methylpiperidin-2-one (PubChem CID 166766008) has the molecular formula C27H23N5O2 and a molecular weight of 449.51 g/mol. Its IUPAC name is (3R)-3-[2-[3-(4-amino-8-phenylpyrido[3,2-d]pyrimidin-6-yl)phenyl]ethynyl]-3-hydroxy-1-methylpiperidin-2-one.
| Compound Name | (3R)-3-[2-[3-(4-amino-8-phenylpyrido[3,2-d]pyrimidin-6-yl)phenyl]ethynyl]-3-hydroxy-1-methylpiperidin-2-one |
|---|---|
| PubChem CID | 166766008 |
| Molecular Formula | C27H23N5O2 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | (3R)-3-[2-[3-(4-amino-8-phenylpyrido[3,2-d]pyrimidin-6-yl)phenyl]ethynyl]-3-hydroxy-1-methylpiperidin-2-one |
| SMILES | CN1CCC[C@@](O)(C#Cc2cccc(-c3cc(-c4ccccc4)c4ncnc(N)c4n3)c2)C1=O |
| InChI | InChI=1S/C27H23N5O2/c1-32-14-6-12-27(34,26(32)33)13-11-18-7-5-10-20(15-18)22-16-21(19-8-3-2-4-9-19)23-24(31-22)25(28)30-17-29-23/h2-5,7-10,15-17,34H,6,12,14H2,1H3,(H2,28,29,30)/t27-/m1/s1 |
| InChIKey | RUIYDMIKSMSNGK-HHHXNRCGSA-N |
| XLogP | 3.28 |
| TPSA | 105.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|