About 4-[2,5-bis(2-methylprop-1-enyl)oxolan-3-yl]butan-2-one
4-[2,5-bis(2-methylprop-1-enyl)oxolan-3-yl]butan-2-one (PubChem CID 166766062) has the molecular formula C16H26O2
and a molecular weight of 250.38 g/mol. Its IUPAC name is 4-[2,5-bis(2-methylprop-1-enyl)oxolan-3-yl]butan-2-one.
Molecular Properties
| Compound Name | 4-[2,5-bis(2-methylprop-1-enyl)oxolan-3-yl]butan-2-one |
| PubChem CID | 166766062 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | 4-[2,5-bis(2-methylprop-1-enyl)oxolan-3-yl]butan-2-one |
| SMILES | CC(=O)CCC1CC(C=C(C)C)OC1C=C(C)C |
| InChI | InChI=1S/C16H26O2/c1-11(2)8-15-10-14(7-6-13(5)17)16(18-15)9-12(3)4/h8-9,14-16H,6-7,10H2,1-5H3 |
| InChIKey | XARNYTRXLJSJPN-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[2,5-bis(2-methylprop-1-enyl)oxolan-3-yl]butan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2,5-bis(2-methylprop-1-enyl)oxolan-3-yl]butan-2-one?
The IUPAC name of 4-[2,5-bis(2-methylprop-1-enyl)oxolan-3-yl]butan-2-one (CID 166766062) is 4-[2,5-bis(2-methylprop-1-enyl)oxolan-3-yl]butan-2-one.
What is the SMILES notation for 4-[2,5-bis(2-methylprop-1-enyl)oxolan-3-yl]butan-2-one?
The canonical SMILES for 4-[2,5-bis(2-methylprop-1-enyl)oxolan-3-yl]butan-2-one is CC(=O)CCC1CC(C=C(C)C)OC1C=C(C)C.
What is the InChIKey of 4-[2,5-bis(2-methylprop-1-enyl)oxolan-3-yl]butan-2-one?
The InChIKey is XARNYTRXLJSJPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26O2/c1-11(2)8-15-10-14(7-6-13(5)17)16(18-15)9-12(3)4/h8-9,14-16H,6-7,10H2,1-5H3.
What are the key properties of 4-[2,5-bis(2-methylprop-1-enyl)oxolan-3-yl]butan-2-one?
4-[2,5-bis(2-methylprop-1-enyl)oxolan-3-yl]butan-2-one has a molecular weight of 250.38 g/mol, XLogP of 4.06, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2,5-bis(2-methylprop-1-enyl)oxolan-3-yl]butan-2-one is sourced from PubChem (CID 166766062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).