C11H14N2 — CID 166766256
N'-[(2E,4Z)-4-ethenylhepta-2,4,6-trien-3-yl]-N-methylidenemethanimidamide (PubChem CID 166766256) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is N'-[(2E,4Z)-4-ethenylhepta-2,4,6-trien-3-yl]-N-methylidenemethanimidamide.
| Compound Name | N'-[(2E,4Z)-4-ethenylhepta-2,4,6-trien-3-yl]-N-methylidenemethanimidamide |
|---|---|
| PubChem CID | 166766256 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | N'-[(2E,4Z)-4-ethenylhepta-2,4,6-trien-3-yl]-N-methylidenemethanimidamide |
| SMILES | C=C/C=C(C=C)\C(=C/C)\N=C\N=C |
| InChI | InChI=1S/C11H14N2/c1-5-8-10(6-2)11(7-3)13-9-12-4/h5-9H,1-2,4H2,3H3/b10-8-,11-7+,13-9+ |
| InChIKey | GNDNBYXMBGJVNR-VZKFLKLSSA-N |
| XLogP | 2.92 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|