C18H21BrN2O6 — CID 166766568
dimethyl 1-bromo-3-[[(2S)-1-formylazetidin-2-yl]methoxy]-4-methyl-5,7-dihydrocyclopenta[c]pyridine-6,6-dicarboxylate (PubChem CID 166766568) has the molecular formula C18H21BrN2O6 and a molecular weight of 441.28 g/mol. Its IUPAC name is dimethyl 1-bromo-3-[[(2S)-1-formylazetidin-2-yl]methoxy]-4-methyl-5,7-dihydrocyclopenta[c]pyridine-6,6-dicarboxylate.
| Compound Name | dimethyl 1-bromo-3-[[(2S)-1-formylazetidin-2-yl]methoxy]-4-methyl-5,7-dihydrocyclopenta[c]pyridine-6,6-dicarboxylate |
|---|---|
| PubChem CID | 166766568 |
| Molecular Formula | C18H21BrN2O6 |
| Molecular Weight | 441.28 g/mol |
| Exact Mass | 440.06 |
| IUPAC Name | dimethyl 1-bromo-3-[[(2S)-1-formylazetidin-2-yl]methoxy]-4-methyl-5,7-dihydrocyclopenta[c]pyridine-6,6-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)Cc2c(Br)nc(OC[C@@H]3CCN3C=O)c(C)c2C1 |
| InChI | InChI=1S/C18H21BrN2O6/c1-10-12-6-18(16(23)25-2,17(24)26-3)7-13(12)14(19)20-15(10)27-8-11-4-5-21(11)9-22/h9,11H,4-8H2,1-3H3/t11-/m0/s1 |
| InChIKey | OUPFIABZWPKABN-NSHDSACASA-N |
| XLogP | 1.19 |
| TPSA | 95.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.28 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|