C18H30N6O — CID 166766677
1-methyl-3-(methylamino)-3-[(1-methylpyrrolidin-2-yl)methyl]-1-[N'-(1-phenylethyl)carbamimidoyl]urea (PubChem CID 166766677) has the molecular formula C18H30N6O and a molecular weight of 346.48 g/mol. Its IUPAC name is 1-methyl-3-(methylamino)-3-[(1-methylpyrrolidin-2-yl)methyl]-1-[N'-(1-phenylethyl)carbamimidoyl]urea.
| Compound Name | 1-methyl-3-(methylamino)-3-[(1-methylpyrrolidin-2-yl)methyl]-1-[N'-(1-phenylethyl)carbamimidoyl]urea |
|---|---|
| PubChem CID | 166766677 |
| Molecular Formula | C18H30N6O |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | 1-methyl-3-(methylamino)-3-[(1-methylpyrrolidin-2-yl)methyl]-1-[N'-(1-phenylethyl)carbamimidoyl]urea |
| SMILES | CNN(CC1CCCN1C)C(=O)N(C)/C(N)=N/C(C)c1ccccc1 |
| InChI | InChI=1S/C18H30N6O/c1-14(15-9-6-5-7-10-15)21-17(19)23(4)18(25)24(20-2)13-16-11-8-12-22(16)3/h5-7,9-10,14,16,20H,8,11-13H2,1-4H3,(H2,19,21) |
| InChIKey | DSVRMYDKIRHQFU-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 77.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|