C19H20F2N2O3 — CID 16676692
(5R,6S)-6-(3,5-difluorophenyl)-5-[(2-hydroxy-3-methoxyphenyl)methylamino]piperidin-2-one (PubChem CID 16676692) has the molecular formula C19H20F2N2O3 and a molecular weight of 362.38 g/mol. Its IUPAC name is (5R,6S)-6-(3,5-difluorophenyl)-5-[(2-hydroxy-3-methoxyphenyl)methylamino]piperidin-2-one.
| Compound Name | (5R,6S)-6-(3,5-difluorophenyl)-5-[(2-hydroxy-3-methoxyphenyl)methylamino]piperidin-2-one |
|---|---|
| PubChem CID | 16676692 |
| Molecular Formula | C19H20F2N2O3 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | (5R,6S)-6-(3,5-difluorophenyl)-5-[(2-hydroxy-3-methoxyphenyl)methylamino]piperidin-2-one |
| SMILES | COc1cccc(CN[C@@H]2CCC(=O)NC2c2cc(F)cc(F)c2)c1O |
| InChI | InChI=1S/C19H20F2N2O3/c1-26-16-4-2-3-11(19(16)25)10-22-15-5-6-17(24)23-18(15)12-7-13(20)9-14(21)8-12/h2-4,7-9,15,18,22,25H,5-6,10H2,1H3,(H,23,24)/t15-,18?/m1/s1 |
| InChIKey | MYBAVOXDCLTNCU-NNJIEVJOSA-N |
| XLogP | 2.79 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|