About (2R)-3-methyl-N-[(1R)-2,2,2-trifluoro-1-methylsulfanylethyl]butan-2-amine
(2R)-3-methyl-N-[(1R)-2,2,2-trifluoro-1-methylsulfanylethyl]butan-2-amine (PubChem CID 166766956) has the molecular formula C8H16F3NS
and a molecular weight of 215.28 g/mol. Its IUPAC name is (2R)-3-methyl-N-[(1R)-2,2,2-trifluoro-1-methylsulfanylethyl]butan-2-amine.
Molecular Properties
| Compound Name | (2R)-3-methyl-N-[(1R)-2,2,2-trifluoro-1-methylsulfanylethyl]butan-2-amine |
| PubChem CID | 166766956 |
| Molecular Formula | C8H16F3NS |
| Molecular Weight | 215.28 g/mol |
| Exact Mass | 215.10 |
| IUPAC Name | (2R)-3-methyl-N-[(1R)-2,2,2-trifluoro-1-methylsulfanylethyl]butan-2-amine |
| SMILES | CS[C@@H](N[C@H](C)C(C)C)C(F)(F)F |
| InChI | InChI=1S/C8H16F3NS/c1-5(2)6(3)12-7(13-4)8(9,10)11/h5-7,12H,1-4H3/t6-,7-/m1/s1 |
| InChIKey | MCYPUQRXTXKACI-RNFRBKRXSA-N |
| XLogP | 2.87 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.28 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (2R)-3-methyl-N-[(1R)-2,2,2-trifluoro-1-methylsulfanylethyl]butan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-3-methyl-N-[(1R)-2,2,2-trifluoro-1-methylsulfanylethyl]butan-2-amine?
The IUPAC name of (2R)-3-methyl-N-[(1R)-2,2,2-trifluoro-1-methylsulfanylethyl]butan-2-amine (CID 166766956) is (2R)-3-methyl-N-[(1R)-2,2,2-trifluoro-1-methylsulfanylethyl]butan-2-amine.
What is the SMILES notation for (2R)-3-methyl-N-[(1R)-2,2,2-trifluoro-1-methylsulfanylethyl]butan-2-amine?
The canonical SMILES for (2R)-3-methyl-N-[(1R)-2,2,2-trifluoro-1-methylsulfanylethyl]butan-2-amine is CS[C@@H](N[C@H](C)C(C)C)C(F)(F)F.
What is the InChIKey of (2R)-3-methyl-N-[(1R)-2,2,2-trifluoro-1-methylsulfanylethyl]butan-2-amine?
The InChIKey is MCYPUQRXTXKACI-RNFRBKRXSA-N. The full InChI is InChI=1S/C8H16F3NS/c1-5(2)6(3)12-7(13-4)8(9,10)11/h5-7,12H,1-4H3/t6-,7-/m1/s1.
What are the key properties of (2R)-3-methyl-N-[(1R)-2,2,2-trifluoro-1-methylsulfanylethyl]butan-2-amine?
(2R)-3-methyl-N-[(1R)-2,2,2-trifluoro-1-methylsulfanylethyl]butan-2-amine has a molecular weight of 215.28 g/mol, XLogP of 2.87, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-3-methyl-N-[(1R)-2,2,2-trifluoro-1-methylsulfanylethyl]butan-2-amine is sourced from PubChem (CID 166766956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).