C15H31N — CID 166767021
(E)-N,9-dimethyl-N-propan-2-yldec-4-en-1-amine (PubChem CID 166767021) has the molecular formula C15H31N and a molecular weight of 225.42 g/mol. Its IUPAC name is (E)-N,9-dimethyl-N-propan-2-yldec-4-en-1-amine.
| Compound Name | (E)-N,9-dimethyl-N-propan-2-yldec-4-en-1-amine |
|---|---|
| PubChem CID | 166767021 |
| Molecular Formula | C15H31N |
| Molecular Weight | 225.42 g/mol |
| Exact Mass | 225.25 |
| IUPAC Name | (E)-N,9-dimethyl-N-propan-2-yldec-4-en-1-amine |
| SMILES | CC(C)CCC/C=C/CCCN(C)C(C)C |
| InChI | InChI=1S/C15H31N/c1-14(2)12-10-8-6-7-9-11-13-16(5)15(3)4/h6-7,14-15H,8-13H2,1-5H3/b7-6+ |
| InChIKey | PSAOIHRHIBTYIX-VOTSOKGWSA-N |
| XLogP | 4.49 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.42 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|