About (E)-2,2-difluoro-N-(2-methylpropyl)-5-propoxypent-3-enamide
(E)-2,2-difluoro-N-(2-methylpropyl)-5-propoxypent-3-enamide (PubChem CID 166767070) has the molecular formula C12H21F2NO2
and a molecular weight of 249.30 g/mol. Its IUPAC name is (E)-2,2-difluoro-N-(2-methylpropyl)-5-propoxypent-3-enamide.
Molecular Properties
| Compound Name | (E)-2,2-difluoro-N-(2-methylpropyl)-5-propoxypent-3-enamide |
| PubChem CID | 166767070 |
| Molecular Formula | C12H21F2NO2 |
| Molecular Weight | 249.30 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | (E)-2,2-difluoro-N-(2-methylpropyl)-5-propoxypent-3-enamide |
| SMILES | CCCOC/C=C/C(F)(F)C(=O)NCC(C)C |
| InChI | InChI=1S/C12H21F2NO2/c1-4-7-17-8-5-6-12(13,14)11(16)15-9-10(2)3/h5-6,10H,4,7-9H2,1-3H3,(H,15,16)/b6-5+ |
| InChIKey | YPNABTCESLSQCS-AATRIKPKSA-N |
| XLogP | 2.38 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.30 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-2,2-difluoro-N-(2-methylpropyl)-5-propoxypent-3-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2,2-difluoro-N-(2-methylpropyl)-5-propoxypent-3-enamide?
The IUPAC name of (E)-2,2-difluoro-N-(2-methylpropyl)-5-propoxypent-3-enamide (CID 166767070) is (E)-2,2-difluoro-N-(2-methylpropyl)-5-propoxypent-3-enamide.
What is the SMILES notation for (E)-2,2-difluoro-N-(2-methylpropyl)-5-propoxypent-3-enamide?
The canonical SMILES for (E)-2,2-difluoro-N-(2-methylpropyl)-5-propoxypent-3-enamide is CCCOC/C=C/C(F)(F)C(=O)NCC(C)C.
What is the InChIKey of (E)-2,2-difluoro-N-(2-methylpropyl)-5-propoxypent-3-enamide?
The InChIKey is YPNABTCESLSQCS-AATRIKPKSA-N. The full InChI is InChI=1S/C12H21F2NO2/c1-4-7-17-8-5-6-12(13,14)11(16)15-9-10(2)3/h5-6,10H,4,7-9H2,1-3H3,(H,15,16)/b6-5+.
What are the key properties of (E)-2,2-difluoro-N-(2-methylpropyl)-5-propoxypent-3-enamide?
(E)-2,2-difluoro-N-(2-methylpropyl)-5-propoxypent-3-enamide has a molecular weight of 249.30 g/mol, XLogP of 2.38, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2,2-difluoro-N-(2-methylpropyl)-5-propoxypent-3-enamide is sourced from PubChem (CID 166767070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).