C30H34BrN5O5 — CID 166767087
(1R,3S,5S)-2-[2-(3-acetyl-7-methylindazol-1-yl)acetyl]-N-[6-bromo-3-(methoxymethyl)-2-pyridinyl]-5-[[(E)-but-2-enoxy]methyl]-2-azabicyclo[3.1.0]hexane-3-carboxamide (PubChem CID 166767087) has the molecular formula C30H34BrN5O5 and a molecular weight of 624.54 g/mol. Its IUPAC name is (1R,3S,5S)-2-[2-(3-acetyl-7-methylindazol-1-yl)acetyl]-N-[6-bromo-3-(methoxymethyl)-2-pyridinyl]-5-[[(E)-but-2-enoxy]methyl]-2-azabicyclo[3.1.0]hexane-3-carboxamide.
| Compound Name | (1R,3S,5S)-2-[2-(3-acetyl-7-methylindazol-1-yl)acetyl]-N-[6-bromo-3-(methoxymethyl)-2-pyridinyl]-5-[[(E)-but-2-enoxy]methyl]-2-azabicyclo[3.1.0]hexane-3-carboxamide |
|---|---|
| PubChem CID | 166767087 |
| Molecular Formula | C30H34BrN5O5 |
| Molecular Weight | 624.54 g/mol |
| Exact Mass | 623.17 |
| IUPAC Name | (1R,3S,5S)-2-[2-(3-acetyl-7-methylindazol-1-yl)acetyl]-N-[6-bromo-3-(methoxymethyl)-2-pyridinyl]-5-[[(E)-but-2-enoxy]methyl]-2-azabicyclo[3.1.0]hexane-3-carboxamide |
| SMILES | C/C=C/COC[C@@]12C[C@@H](C(=O)Nc3nc(Br)ccc3COC)N(C(=O)Cn3nc(C(C)=O)c4cccc(C)c43)[C@@H]1C2 |
| InChI | InChI=1S/C30H34BrN5O5/c1-5-6-12-41-17-30-13-22(29(39)33-28-20(16-40-4)10-11-24(31)32-28)36(23(30)14-30)25(38)15-35-27-18(2)8-7-9-21(27)26(34-35)19(3)37/h5-11,22-23H,12-17H2,1-4H3,(H,32,33,39)/b6-5+/t22-,23+,30-/m0/s1 |
| InChIKey | YETLHKIGWONGGJ-KBTDOEQPSA-N |
| XLogP | 4.44 |
| TPSA | 115.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.54 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|