C21H38N2 — CID 166767209
(3aR,6aS)-2-[[(3S,5R)-2,3-ditert-butyl-2-azabicyclo[3.1.0]hexan-5-yl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole (PubChem CID 166767209) has the molecular formula C21H38N2 and a molecular weight of 318.55 g/mol. Its IUPAC name is (3aR,6aS)-2-[[(3S,5R)-2,3-ditert-butyl-2-azabicyclo[3.1.0]hexan-5-yl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole.
| Compound Name | (3aR,6aS)-2-[[(3S,5R)-2,3-ditert-butyl-2-azabicyclo[3.1.0]hexan-5-yl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
|---|---|
| PubChem CID | 166767209 |
| Molecular Formula | C21H38N2 |
| Molecular Weight | 318.55 g/mol |
| Exact Mass | 318.30 |
| IUPAC Name | (3aR,6aS)-2-[[(3S,5R)-2,3-ditert-butyl-2-azabicyclo[3.1.0]hexan-5-yl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
| SMILES | CC(C)(C)[C@@H]1C[C@@]2(CN3C[C@H]4CCC[C@H]4C3)CC2N1C(C)(C)C |
| InChI | InChI=1S/C21H38N2/c1-19(2,3)17-10-21(11-18(21)23(17)20(4,5)6)14-22-12-15-8-7-9-16(15)13-22/h15-18H,7-14H2,1-6H3/t15-,16+,17-,18?,21-/m0/s1 |
| InChIKey | FTVLCXVZXYBMFA-GCRAJQQTSA-N |
| XLogP | 4.40 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.55 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |