C12H24FNO — CID 166767225
(2R,3R,4R)-1,2-ditert-butyl-4-fluoropyrrolidin-3-ol (PubChem CID 166767225) has the molecular formula C12H24FNO and a molecular weight of 217.33 g/mol. Its IUPAC name is (2R,3R,4R)-1,2-ditert-butyl-4-fluoropyrrolidin-3-ol.
| Compound Name | (2R,3R,4R)-1,2-ditert-butyl-4-fluoropyrrolidin-3-ol |
|---|---|
| PubChem CID | 166767225 |
| Molecular Formula | C12H24FNO |
| Molecular Weight | 217.33 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | (2R,3R,4R)-1,2-ditert-butyl-4-fluoropyrrolidin-3-ol |
| SMILES | CC(C)(C)[C@@H]1[C@@H](O)[C@H](F)CN1C(C)(C)C |
| InChI | InChI=1S/C12H24FNO/c1-11(2,3)10-9(15)8(13)7-14(10)12(4,5)6/h8-10,15H,7H2,1-6H3/t8-,9+,10+/m1/s1 |
| InChIKey | OXZMJCCTRVAIIN-UTLUCORTSA-N |
| XLogP | 2.21 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.33 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |