C12H25NO2S — CID 166767239
N-cyclopropyl-2-methyl-N-[(2S)-pentan-2-yl]propane-2-sulfonamide (PubChem CID 166767239) has the molecular formula C12H25NO2S and a molecular weight of 247.40 g/mol. Its IUPAC name is N-cyclopropyl-2-methyl-N-[(2S)-pentan-2-yl]propane-2-sulfonamide.
| Compound Name | N-cyclopropyl-2-methyl-N-[(2S)-pentan-2-yl]propane-2-sulfonamide |
|---|---|
| PubChem CID | 166767239 |
| Molecular Formula | C12H25NO2S |
| Molecular Weight | 247.40 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | N-cyclopropyl-2-methyl-N-[(2S)-pentan-2-yl]propane-2-sulfonamide |
| SMILES | CCC[C@H](C)N(C1CC1)S(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C12H25NO2S/c1-6-7-10(2)13(11-8-9-11)16(14,15)12(3,4)5/h10-11H,6-9H2,1-5H3/t10-/m0/s1 |
| InChIKey | AMICUTCRSBKABN-JTQLQIEISA-N |
| XLogP | 2.77 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.40 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |