About (3S,5S)-2,3-ditert-butyl-5-(trifluoromethyl)-2-azabicyclo[3.1.0]hexane
(3S,5S)-2,3-ditert-butyl-5-(trifluoromethyl)-2-azabicyclo[3.1.0]hexane (PubChem CID 166767252) has the molecular formula C14H24F3N
and a molecular weight of 263.35 g/mol. Its IUPAC name is (3S,5S)-2,3-ditert-butyl-5-(trifluoromethyl)-2-azabicyclo[3.1.0]hexane.
Molecular Properties
| Compound Name | (3S,5S)-2,3-ditert-butyl-5-(trifluoromethyl)-2-azabicyclo[3.1.0]hexane |
| PubChem CID | 166767252 |
| Molecular Formula | C14H24F3N |
| Molecular Weight | 263.35 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | (3S,5S)-2,3-ditert-butyl-5-(trifluoromethyl)-2-azabicyclo[3.1.0]hexane |
| SMILES | CC(C)(C)[C@@H]1C[C@@]2(C(F)(F)F)CC2N1C(C)(C)C |
| InChI | InChI=1S/C14H24F3N/c1-11(2,3)9-7-13(14(15,16)17)8-10(13)18(9)12(4,5)6/h9-10H,7-8H2,1-6H3/t9-,10?,13+/m0/s1 |
| InChIKey | BYZQSRJHZWXYPX-BOURZNODSA-N |
| XLogP | 4.23 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.35 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3S,5S)-2,3-ditert-butyl-5-(trifluoromethyl)-2-azabicyclo[3.1.0]hexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,5S)-2,3-ditert-butyl-5-(trifluoromethyl)-2-azabicyclo[3.1.0]hexane?
The IUPAC name of (3S,5S)-2,3-ditert-butyl-5-(trifluoromethyl)-2-azabicyclo[3.1.0]hexane (CID 166767252) is (3S,5S)-2,3-ditert-butyl-5-(trifluoromethyl)-2-azabicyclo[3.1.0]hexane.
What is the SMILES notation for (3S,5S)-2,3-ditert-butyl-5-(trifluoromethyl)-2-azabicyclo[3.1.0]hexane?
The canonical SMILES for (3S,5S)-2,3-ditert-butyl-5-(trifluoromethyl)-2-azabicyclo[3.1.0]hexane is CC(C)(C)[C@@H]1C[C@@]2(C(F)(F)F)CC2N1C(C)(C)C.
What is the InChIKey of (3S,5S)-2,3-ditert-butyl-5-(trifluoromethyl)-2-azabicyclo[3.1.0]hexane?
The InChIKey is BYZQSRJHZWXYPX-BOURZNODSA-N. The full InChI is InChI=1S/C14H24F3N/c1-11(2,3)9-7-13(14(15,16)17)8-10(13)18(9)12(4,5)6/h9-10H,7-8H2,1-6H3/t9-,10?,13+/m0/s1.
What are the key properties of (3S,5S)-2,3-ditert-butyl-5-(trifluoromethyl)-2-azabicyclo[3.1.0]hexane?
(3S,5S)-2,3-ditert-butyl-5-(trifluoromethyl)-2-azabicyclo[3.1.0]hexane has a molecular weight of 263.35 g/mol, XLogP of 4.23, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,5S)-2,3-ditert-butyl-5-(trifluoromethyl)-2-azabicyclo[3.1.0]hexane is sourced from PubChem (CID 166767252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).