C14H15ClIN3O2 — CID 166767357
(2R)-2-(4-chloro-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-3-ol (PubChem CID 166767357) has the molecular formula C14H15ClIN3O2 and a molecular weight of 419.65 g/mol. Its IUPAC name is (2R)-2-(4-chloro-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-3-ol.
| Compound Name | (2R)-2-(4-chloro-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-3-ol |
|---|---|
| PubChem CID | 166767357 |
| Molecular Formula | C14H15ClIN3O2 |
| Molecular Weight | 419.65 g/mol |
| Exact Mass | 418.99 |
| IUPAC Name | (2R)-2-(4-chloro-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-3-ol |
| SMILES | OC1C2CCCCC2O[C@H]1n1cc(I)c2c(Cl)ncnc21 |
| InChI | InChI=1S/C14H15ClIN3O2/c15-12-10-8(16)5-19(13(10)18-6-17-12)14-11(20)7-3-1-2-4-9(7)21-14/h5-7,9,11,14,20H,1-4H2/t7?,9?,11?,14-/m1/s1 |
| InChIKey | LMTXDICNEUKTSW-PNTOACNRSA-N |
| XLogP | 3.14 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.65 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|