About (Z)-6-ethylsulfanyl-2,3-dimethyl-4-methylidene-N-propyloct-6-en-2-amine
(Z)-6-ethylsulfanyl-2,3-dimethyl-4-methylidene-N-propyloct-6-en-2-amine (PubChem CID 166767361) has the molecular formula C16H31NS
and a molecular weight of 269.50 g/mol. Its IUPAC name is (Z)-6-ethylsulfanyl-2,3-dimethyl-4-methylidene-N-propyloct-6-en-2-amine.
Molecular Properties
| Compound Name | (Z)-6-ethylsulfanyl-2,3-dimethyl-4-methylidene-N-propyloct-6-en-2-amine |
| PubChem CID | 166767361 |
| Molecular Formula | C16H31NS |
| Molecular Weight | 269.50 g/mol |
| Exact Mass | 269.22 |
| IUPAC Name | (Z)-6-ethylsulfanyl-2,3-dimethyl-4-methylidene-N-propyloct-6-en-2-amine |
| SMILES | C=C(C/C(=C/C)SCC)C(C)C(C)(C)NCCC |
| InChI | InChI=1S/C16H31NS/c1-8-11-17-16(6,7)14(5)13(4)12-15(9-2)18-10-3/h9,14,17H,4,8,10-12H2,1-3,5-7H3/b15-9- |
| InChIKey | XIWHTBDEUOAIBZ-DHDCSXOGSA-N |
| XLogP | 5.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 269.50 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-6-ethylsulfanyl-2,3-dimethyl-4-methylidene-N-propyloct-6-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-6-ethylsulfanyl-2,3-dimethyl-4-methylidene-N-propyloct-6-en-2-amine?
The IUPAC name of (Z)-6-ethylsulfanyl-2,3-dimethyl-4-methylidene-N-propyloct-6-en-2-amine (CID 166767361) is (Z)-6-ethylsulfanyl-2,3-dimethyl-4-methylidene-N-propyloct-6-en-2-amine.
What is the SMILES notation for (Z)-6-ethylsulfanyl-2,3-dimethyl-4-methylidene-N-propyloct-6-en-2-amine?
The canonical SMILES for (Z)-6-ethylsulfanyl-2,3-dimethyl-4-methylidene-N-propyloct-6-en-2-amine is C=C(C/C(=C/C)SCC)C(C)C(C)(C)NCCC.
What is the InChIKey of (Z)-6-ethylsulfanyl-2,3-dimethyl-4-methylidene-N-propyloct-6-en-2-amine?
The InChIKey is XIWHTBDEUOAIBZ-DHDCSXOGSA-N. The full InChI is InChI=1S/C16H31NS/c1-8-11-17-16(6,7)14(5)13(4)12-15(9-2)18-10-3/h9,14,17H,4,8,10-12H2,1-3,5-7H3/b15-9-.
What are the key properties of (Z)-6-ethylsulfanyl-2,3-dimethyl-4-methylidene-N-propyloct-6-en-2-amine?
(Z)-6-ethylsulfanyl-2,3-dimethyl-4-methylidene-N-propyloct-6-en-2-amine has a molecular weight of 269.50 g/mol, XLogP of 5.00, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-6-ethylsulfanyl-2,3-dimethyl-4-methylidene-N-propyloct-6-en-2-amine is sourced from PubChem (CID 166767361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).