C20H24FNO6 — CID 166767383
5-cyclobutyl-2-[(1R)-1-fluoro-2-hydroxy-2-[(4R)-5-hydroxy-2,2-dimethyl-1,3-dioxan-4-yl]ethyl]isoindole-1,3-dione (PubChem CID 166767383) has the molecular formula C20H24FNO6 and a molecular weight of 393.41 g/mol. Its IUPAC name is 5-cyclobutyl-2-[(1R)-1-fluoro-2-hydroxy-2-[(4R)-5-hydroxy-2,2-dimethyl-1,3-dioxan-4-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 5-cyclobutyl-2-[(1R)-1-fluoro-2-hydroxy-2-[(4R)-5-hydroxy-2,2-dimethyl-1,3-dioxan-4-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 166767383 |
| Molecular Formula | C20H24FNO6 |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 5-cyclobutyl-2-[(1R)-1-fluoro-2-hydroxy-2-[(4R)-5-hydroxy-2,2-dimethyl-1,3-dioxan-4-yl]ethyl]isoindole-1,3-dione |
| SMILES | CC1(C)OCC(O)[C@H](C(O)[C@@H](F)N2C(=O)c3ccc(C4CCC4)cc3C2=O)O1 |
| InChI | InChI=1S/C20H24FNO6/c1-20(2)27-9-14(23)16(28-20)15(24)17(21)22-18(25)12-7-6-11(10-4-3-5-10)8-13(12)19(22)26/h6-8,10,14-17,23-24H,3-5,9H2,1-2H3/t14?,15?,16-,17+/m1/s1 |
| InChIKey | UBASZFGEMKSUQU-BACDZXNISA-N |
| XLogP | 1.72 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|