About N-[2-[4-(6-chloro-1,2-benzoxazol-3-yl)piperidine-1-carbonyl]butyl]formamide
N-[2-[4-(6-chloro-1,2-benzoxazol-3-yl)piperidine-1-carbonyl]butyl]formamide (PubChem CID 166767469) has the molecular formula C18H22ClN3O3
and a molecular weight of 363.85 g/mol. Its IUPAC name is N-[2-[4-(6-chloro-1,2-benzoxazol-3-yl)piperidine-1-carbonyl]butyl]formamide.
Molecular Properties
| Compound Name | N-[2-[4-(6-chloro-1,2-benzoxazol-3-yl)piperidine-1-carbonyl]butyl]formamide |
| PubChem CID | 166767469 |
| Molecular Formula | C18H22ClN3O3 |
| Molecular Weight | 363.85 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | N-[2-[4-(6-chloro-1,2-benzoxazol-3-yl)piperidine-1-carbonyl]butyl]formamide |
| SMILES | CCC(CNC=O)C(=O)N1CCC(c2noc3cc(Cl)ccc23)CC1 |
| InChI | InChI=1S/C18H22ClN3O3/c1-2-12(10-20-11-23)18(24)22-7-5-13(6-8-22)17-15-4-3-14(19)9-16(15)25-21-17/h3-4,9,11-13H,2,5-8,10H2,1H3,(H,20,23) |
| InChIKey | FLNINWGMJSDSEE-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.85 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[4-(6-chloro-1,2-benzoxazol-3-yl)piperidine-1-carbonyl]butyl]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[4-(6-chloro-1,2-benzoxazol-3-yl)piperidine-1-carbonyl]butyl]formamide?
The IUPAC name of N-[2-[4-(6-chloro-1,2-benzoxazol-3-yl)piperidine-1-carbonyl]butyl]formamide (CID 166767469) is N-[2-[4-(6-chloro-1,2-benzoxazol-3-yl)piperidine-1-carbonyl]butyl]formamide.
What is the SMILES notation for N-[2-[4-(6-chloro-1,2-benzoxazol-3-yl)piperidine-1-carbonyl]butyl]formamide?
The canonical SMILES for N-[2-[4-(6-chloro-1,2-benzoxazol-3-yl)piperidine-1-carbonyl]butyl]formamide is CCC(CNC=O)C(=O)N1CCC(c2noc3cc(Cl)ccc23)CC1.
What is the InChIKey of N-[2-[4-(6-chloro-1,2-benzoxazol-3-yl)piperidine-1-carbonyl]butyl]formamide?
The InChIKey is FLNINWGMJSDSEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22ClN3O3/c1-2-12(10-20-11-23)18(24)22-7-5-13(6-8-22)17-15-4-3-14(19)9-16(15)25-21-17/h3-4,9,11-13H,2,5-8,10H2,1H3,(H,20,23).
What are the key properties of N-[2-[4-(6-chloro-1,2-benzoxazol-3-yl)piperidine-1-carbonyl]butyl]formamide?
N-[2-[4-(6-chloro-1,2-benzoxazol-3-yl)piperidine-1-carbonyl]butyl]formamide has a molecular weight of 363.85 g/mol, XLogP of 2.96, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[4-(6-chloro-1,2-benzoxazol-3-yl)piperidine-1-carbonyl]butyl]formamide is sourced from PubChem (CID 166767469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).