C20H17N2O5S2- — CID 166768092
2-[[[2-(carboxymethyl)-1,3-dihydroindene-2-carbonyl]amino]methyl]-1,3-benzothiazole-4-sulfinate (PubChem CID 166768092) has the molecular formula C20H17N2O5S2- and a molecular weight of 429.50 g/mol. Its IUPAC name is 2-[[[2-(carboxymethyl)-1,3-dihydroindene-2-carbonyl]amino]methyl]-1,3-benzothiazole-4-sulfinate.
| Compound Name | 2-[[[2-(carboxymethyl)-1,3-dihydroindene-2-carbonyl]amino]methyl]-1,3-benzothiazole-4-sulfinate |
|---|---|
| PubChem CID | 166768092 |
| Molecular Formula | C20H17N2O5S2- |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.06 |
| IUPAC Name | 2-[[[2-(carboxymethyl)-1,3-dihydroindene-2-carbonyl]amino]methyl]-1,3-benzothiazole-4-sulfinate |
| SMILES | O=C(O)CC1(C(=O)NCc2nc3c(S(=O)[O-])cccc3s2)Cc2ccccc2C1 |
| InChI | InChI=1S/C20H18N2O5S2/c23-17(24)10-20(8-12-4-1-2-5-13(12)9-20)19(25)21-11-16-22-18-14(28-16)6-3-7-15(18)29(26)27/h1-7H,8-11H2,(H,21,25)(H,23,24)(H,26,27)/p-1 |
| InChIKey | FRNVXGHFLMEFNO-UHFFFAOYSA-M |
| XLogP | 2.41 |
| TPSA | 119.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|