C9H15N5 — CID 166768557
(3E)-4-N-[2-(1,2,4-triazol-1-yl)ethyl]penta-1,3-diene-2,4-diamine (PubChem CID 166768557) has the molecular formula C9H15N5 and a molecular weight of 193.25 g/mol. Its IUPAC name is (3E)-4-N-[2-(1,2,4-triazol-1-yl)ethyl]penta-1,3-diene-2,4-diamine.
| Compound Name | (3E)-4-N-[2-(1,2,4-triazol-1-yl)ethyl]penta-1,3-diene-2,4-diamine |
|---|---|
| PubChem CID | 166768557 |
| Molecular Formula | C9H15N5 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | (3E)-4-N-[2-(1,2,4-triazol-1-yl)ethyl]penta-1,3-diene-2,4-diamine |
| SMILES | C=C(N)/C=C(\C)NCCn1cncn1 |
| InChI | InChI=1S/C9H15N5/c1-8(10)5-9(2)12-3-4-14-7-11-6-13-14/h5-7,12H,1,3-4,10H2,2H3/b9-5+ |
| InChIKey | KLJORFANKJMJMB-WEVVVXLNSA-N |
| XLogP | 0.24 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|