C20H21ClF2N2O2 — CID 16676886
2-chloro-6-fluoro-N-[2-[4-(4-fluorophenyl)-4-hydroxypiperidin-1-yl]ethyl]benzamide (PubChem CID 16676886) has the molecular formula C20H21ClF2N2O2 and a molecular weight of 394.85 g/mol. Its IUPAC name is 2-chloro-6-fluoro-N-[2-[4-(4-fluorophenyl)-4-hydroxypiperidin-1-yl]ethyl]benzamide.
| Compound Name | 2-chloro-6-fluoro-N-[2-[4-(4-fluorophenyl)-4-hydroxypiperidin-1-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 16676886 |
| Molecular Formula | C20H21ClF2N2O2 |
| Molecular Weight | 394.85 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | 2-chloro-6-fluoro-N-[2-[4-(4-fluorophenyl)-4-hydroxypiperidin-1-yl]ethyl]benzamide |
| SMILES | O=C(NCCN1CCC(O)(c2ccc(F)cc2)CC1)c1c(F)cccc1Cl |
| InChI | InChI=1S/C20H21ClF2N2O2/c21-16-2-1-3-17(23)18(16)19(26)24-10-13-25-11-8-20(27,9-12-25)14-4-6-15(22)7-5-14/h1-7,27H,8-13H2,(H,24,26) |
| InChIKey | KRFRMNUXVGQLJE-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.85 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |