C26H26F4N8O2S — CID 166769252
[1-(4-fluorophenyl)-7-[hydroxy-(2-methyltriazol-4-yl)sulfanylamino]-5,6,8,9,10,11-hexahydro-4H-pyrazolo[4,5-e]azecin-10-yl]-[4-(trifluoromethyl)-2-pyridinyl]methanone (PubChem CID 166769252) has the molecular formula C26H26F4N8O2S and a molecular weight of 590.61 g/mol. Its IUPAC name is [1-(4-fluorophenyl)-7-[hydroxy-(2-methyltriazol-4-yl)sulfanylamino]-5,6,8,9,10,11-hexahydro-4H-pyrazolo[4,5-e]azecin-10-yl]-[4-(trifluoromethyl)-2-pyridinyl]methanone.
| Compound Name | [1-(4-fluorophenyl)-7-[hydroxy-(2-methyltriazol-4-yl)sulfanylamino]-5,6,8,9,10,11-hexahydro-4H-pyrazolo[4,5-e]azecin-10-yl]-[4-(trifluoromethyl)-2-pyridinyl]methanone |
|---|---|
| PubChem CID | 166769252 |
| Molecular Formula | C26H26F4N8O2S |
| Molecular Weight | 590.61 g/mol |
| Exact Mass | 590.18 |
| IUPAC Name | [1-(4-fluorophenyl)-7-[hydroxy-(2-methyltriazol-4-yl)sulfanylamino]-5,6,8,9,10,11-hexahydro-4H-pyrazolo[4,5-e]azecin-10-yl]-[4-(trifluoromethyl)-2-pyridinyl]methanone |
| SMILES | Cn1ncc(SN(O)N2CCCc3cnn(-c4ccc(F)cc4)c3CC(C(=O)c3cc(C(F)(F)F)ccn3)CC2)n1 |
| InChI | InChI=1S/C26H26F4N8O2S/c1-35-32-16-24(34-35)41-38(40)36-11-2-3-18-15-33-37(21-6-4-20(27)5-7-21)23(18)13-17(9-12-36)25(39)22-14-19(8-10-31-22)26(28,29)30/h4-8,10,14-17,40H,2-3,9,11-13H2,1H3 |
| InChIKey | BFKYXSJOBJZVRP-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 105.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.61 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|