C13H22O3 — CID 166769451
2-[(1-hydroxy-3,3,5-trimethylcyclohexyl)methyl]prop-2-enoic acid (PubChem CID 166769451) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is 2-[(1-hydroxy-3,3,5-trimethylcyclohexyl)methyl]prop-2-enoic acid.
| Compound Name | 2-[(1-hydroxy-3,3,5-trimethylcyclohexyl)methyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 166769451 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | 2-[(1-hydroxy-3,3,5-trimethylcyclohexyl)methyl]prop-2-enoic acid |
| SMILES | C=C(CC1(O)CC(C)CC(C)(C)C1)C(=O)O |
| InChI | InChI=1S/C13H22O3/c1-9-5-12(3,4)8-13(16,6-9)7-10(2)11(14)15/h9,16H,2,5-8H2,1,3-4H3,(H,14,15) |
| InChIKey | DGVSXAZYMWUIHS-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|