About [1-(3,5-difluorophenyl)cyclopropyl] N-methylcarbamate
[1-(3,5-difluorophenyl)cyclopropyl] N-methylcarbamate (PubChem CID 166769657) has the molecular formula C11H11F2NO2
and a molecular weight of 227.21 g/mol. Its IUPAC name is [1-(3,5-difluorophenyl)cyclopropyl] N-methylcarbamate.
Molecular Properties
| Compound Name | [1-(3,5-difluorophenyl)cyclopropyl] N-methylcarbamate |
| PubChem CID | 166769657 |
| Molecular Formula | C11H11F2NO2 |
| Molecular Weight | 227.21 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | [1-(3,5-difluorophenyl)cyclopropyl] N-methylcarbamate |
| SMILES | CNC(=O)OC1(c2cc(F)cc(F)c2)CC1 |
| InChI | InChI=1S/C11H11F2NO2/c1-14-10(15)16-11(2-3-11)7-4-8(12)6-9(13)5-7/h4-6H,2-3H2,1H3,(H,14,15) |
| InChIKey | FQJZKOCYDKKODA-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.21 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [1-(3,5-difluorophenyl)cyclopropyl] N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(3,5-difluorophenyl)cyclopropyl] N-methylcarbamate?
The IUPAC name of [1-(3,5-difluorophenyl)cyclopropyl] N-methylcarbamate (CID 166769657) is [1-(3,5-difluorophenyl)cyclopropyl] N-methylcarbamate.
What is the SMILES notation for [1-(3,5-difluorophenyl)cyclopropyl] N-methylcarbamate?
The canonical SMILES for [1-(3,5-difluorophenyl)cyclopropyl] N-methylcarbamate is CNC(=O)OC1(c2cc(F)cc(F)c2)CC1.
What is the InChIKey of [1-(3,5-difluorophenyl)cyclopropyl] N-methylcarbamate?
The InChIKey is FQJZKOCYDKKODA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11F2NO2/c1-14-10(15)16-11(2-3-11)7-4-8(12)6-9(13)5-7/h4-6H,2-3H2,1H3,(H,14,15).
What are the key properties of [1-(3,5-difluorophenyl)cyclopropyl] N-methylcarbamate?
[1-(3,5-difluorophenyl)cyclopropyl] N-methylcarbamate has a molecular weight of 227.21 g/mol, XLogP of 2.31, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(3,5-difluorophenyl)cyclopropyl] N-methylcarbamate is sourced from PubChem (CID 166769657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).