C24H43N — CID 166770390
N-[(2E)-3,7-dimethylocta-2,6-dienyl]-7,7-dimethyl-N-pentylbicyclo[2.2.1]heptan-2-amine (PubChem CID 166770390) has the molecular formula C24H43N and a molecular weight of 345.62 g/mol. Its IUPAC name is N-[(2E)-3,7-dimethylocta-2,6-dienyl]-7,7-dimethyl-N-pentylbicyclo[2.2.1]heptan-2-amine.
| Compound Name | N-[(2E)-3,7-dimethylocta-2,6-dienyl]-7,7-dimethyl-N-pentylbicyclo[2.2.1]heptan-2-amine |
|---|---|
| PubChem CID | 166770390 |
| Molecular Formula | C24H43N |
| Molecular Weight | 345.62 g/mol |
| Exact Mass | 345.34 |
| IUPAC Name | N-[(2E)-3,7-dimethylocta-2,6-dienyl]-7,7-dimethyl-N-pentylbicyclo[2.2.1]heptan-2-amine |
| SMILES | CCCCCN(C/C=C(\C)CCC=C(C)C)C1CC2CCC1C2(C)C |
| InChI | InChI=1S/C24H43N/c1-7-8-9-16-25(17-15-20(4)12-10-11-19(2)3)23-18-21-13-14-22(23)24(21,5)6/h11,15,21-23H,7-10,12-14,16-18H2,1-6H3/b20-15+ |
| InChIKey | QGORJDNYILWYCH-HMMYKYKNSA-N |
| XLogP | 7.00 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.62 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|