C14H17NS — CID 166770520
(4E,5Z)-2-ethenylsulfanyl-N-methyl-4-prop-2-enylideneocta-1,5,7-trien-3-imine (PubChem CID 166770520) has the molecular formula C14H17NS and a molecular weight of 231.36 g/mol. Its IUPAC name is (4E,5Z)-2-ethenylsulfanyl-N-methyl-4-prop-2-enylideneocta-1,5,7-trien-3-imine.
| Compound Name | (4E,5Z)-2-ethenylsulfanyl-N-methyl-4-prop-2-enylideneocta-1,5,7-trien-3-imine |
|---|---|
| PubChem CID | 166770520 |
| Molecular Formula | C14H17NS |
| Molecular Weight | 231.36 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | (4E,5Z)-2-ethenylsulfanyl-N-methyl-4-prop-2-enylideneocta-1,5,7-trien-3-imine |
| SMILES | C=C/C=C\C(=C/C=C)\C(=N\C)C(=C)SC=C |
| InChI | InChI=1S/C14H17NS/c1-6-9-11-13(10-7-2)14(15-5)12(4)16-8-3/h6-11H,1-4H2,5H3/b11-9-,13-10+,15-14+ |
| InChIKey | YPFGHMRBAUZHDW-OUVICSHYSA-N |
| XLogP | 4.30 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.36 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|