C23H20N2O5 — CID 166771523
4-[(8-methyl-4-oxo-2,3-dihydrochromen-7-yl)oxy-(1-oxidopyridin-1-ium-2-yl)methyl]benzamide (PubChem CID 166771523) has the molecular formula C23H20N2O5 and a molecular weight of 404.42 g/mol. Its IUPAC name is 4-[(8-methyl-4-oxo-2,3-dihydrochromen-7-yl)oxy-(1-oxidopyridin-1-ium-2-yl)methyl]benzamide.
| Compound Name | 4-[(8-methyl-4-oxo-2,3-dihydrochromen-7-yl)oxy-(1-oxidopyridin-1-ium-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 166771523 |
| Molecular Formula | C23H20N2O5 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 4-[(8-methyl-4-oxo-2,3-dihydrochromen-7-yl)oxy-(1-oxidopyridin-1-ium-2-yl)methyl]benzamide |
| SMILES | Cc1c(OC(c2ccc(C(N)=O)cc2)c2cccc[n+]2[O-])ccc2c1OCCC2=O |
| InChI | InChI=1S/C23H20N2O5/c1-14-20(10-9-17-19(26)11-13-29-21(14)17)30-22(18-4-2-3-12-25(18)28)15-5-7-16(8-6-15)23(24)27/h2-10,12,22H,11,13H2,1H3,(H2,24,27) |
| InChIKey | ZZKFRVCXUTYZAW-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|